Products 1428234-53-0

CAS 1428234-53-0 is the registry number for 3-Chloro-2,6-difluorothioanisole, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.

Structural formula: {0} (CAS {1})

1-chloro-2,4-difluoro-3-methylsulfanylbenzene (CAS 1428234-53-0) is a chemical compound with the molecular formula C7H5ClF2S and a molecular weight of 194.63 g/mol. IUPAC name: 1-chloro-2,4-difluoro-3-methylsulfanylbenzene. InChIKey: JCVRCFCSYHNECO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5ClF2S
Molecular weight194.63 g/mol
IUPAC name1-chloro-2,4-difluoro-3-methylsulfanylbenzene
InChIKeyJCVRCFCSYHNECO-UHFFFAOYSA-N
SMILESCSC1=C(C=CC(=C1F)Cl)F

Computed by PubChem (NCBI)