CAS 1428236-21-8 appears in our catalog under these names: 5-Bromo-2-iodo-1,3-benzenedicarboxylic acid, 97%, 5-Bromo-2-iodoisophthalic acid, 97%, 5-Bromo-2-iodo-1,3-benzenedicarboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
5-bromo-2-iodobenzene-1,3-dicarboxylic acid (CAS 1428236-21-8) is a chemical compound with the molecular formula C8H4BrIO4 and a molecular weight of 370.92 g/mol. IUPAC name: 5-bromo-2-iodobenzene-1,3-dicarboxylic acid. InChIKey: AXKNIHOOTXODNH-UHFFFAOYSA-N.
| Molecular formula | C8H4BrIO4 |
|---|---|
| Molecular weight | 370.92 g/mol |
| IUPAC name | 5-bromo-2-iodobenzene-1,3-dicarboxylic acid |
| InChIKey | AXKNIHOOTXODNH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)I)C(=O)O)Br |
Computed by PubChem (NCBI)