CAS 1428324-58-6 is the registry number for Abasic succiante. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid (CAS 1428324-58-6) is a chemical compound with the molecular formula C30H32O8 and a molecular weight of 520.6 g/mol. IUPAC name: 4-[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid. InChIKey: PURLJYSNZCUYOW-RRPNLBNLSA-N.
| Molecular formula | C30H32O8 |
|---|---|
| Molecular weight | 520.6 g/mol |
| IUPAC name | 4-[(2R,3S)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-3-yl]oxy-4-oxobutanoic acid |
| InChIKey | PURLJYSNZCUYOW-RRPNLBNLSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OC[C@@H]4[C@H](CCO4)OC(=O)CCC(=O)O |
Computed by PubChem (NCBI)