Products 142838-82-2
CAS 142838-82-2 appears in our catalog under these names: Blonanserin Impurity 12, Blonanserin Impurity K, Blonanserin N-Oxide, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
2-(4-ethyl-4-oxidopiperazin-4-ium-1-yl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine (CAS 142838-82-2) is a chemical compound with the molecular formula C23H30FN3O and a molecular weight of 383.5 g/mol. IUPAC name: 2-(4-ethyl-4-oxidopiperazin-4-ium-1-yl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine. InChIKey: OTCKVXVFRUCJOH-UHFFFAOYSA-N.
| Molecular formula | C23H30FN3O |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 2-(4-ethyl-4-oxidopiperazin-4-ium-1-yl)-4-(4-fluorophenyl)-5,6,7,8,9,10-hexahydrocycloocta[b]pyridine |
| InChIKey | OTCKVXVFRUCJOH-UHFFFAOYSA-N |
| SMILES | CC[N+]1(CCN(CC1)C2=NC3=C(CCCCCC3)C(=C2)C4=CC=C(C=C4)F)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Blonanserin N-Oxide, Blonanserin Impurity K