Products 1428422-55-2
CAS 1428422-55-2 is the registry number for AMPK activator C2. Offered by: MedChemExpress. Available pack sizes: Get quote.
[5-(5-oxo-2H-1,2-oxazol-3-yl)furan-2-yl]phosphonic acid (CAS 1428422-55-2) is a chemical compound with the molecular formula C7H6NO6P and a molecular weight of 231.10 g/mol. IUPAC name: [5-(5-oxo-2H-1,2-oxazol-3-yl)furan-2-yl]phosphonic acid. InChIKey: YKUMOJFFFVMJIE-UHFFFAOYSA-N.
| Molecular formula | C7H6NO6P |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | [5-(5-oxo-2H-1,2-oxazol-3-yl)furan-2-yl]phosphonic acid |
| InChIKey | YKUMOJFFFVMJIE-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)P(=O)(O)O)C2=CC(=O)ON2 |
Computed by PubChem (NCBI)