CAS 1428532-93-7 appears in our catalog under these names: 8-Chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3(2h)-one, 95%, 8-Chloro-6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3(2H)-one, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 250mg, 100mg.
8-chloro-6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one (CAS 1428532-93-7) is a chemical compound with the molecular formula C7H3ClF3N3O and a molecular weight of 237.56 g/mol. IUPAC name: 8-chloro-6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one. InChIKey: ZEWPPMJHVMHLHL-UHFFFAOYSA-N.
| Molecular formula | C7H3ClF3N3O |
|---|---|
| Molecular weight | 237.56 g/mol |
| IUPAC name | 8-chloro-6-(trifluoromethyl)-2H-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| InChIKey | ZEWPPMJHVMHLHL-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NNC(=O)N2C=C1C(F)(F)F)Cl |
Computed by PubChem (NCBI)