CAS 1428553-61-0 is the registry number for Glipizide Impurity 1 HCl. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(2-aminoethyl)phenyl]sulfonyl-3-cyclohexylurea;hydrochloride (CAS 1428553-61-0) is a chemical compound with the molecular formula C15H24ClN3O3S and a molecular weight of 361.9 g/mol. IUPAC name: 1-[4-(2-aminoethyl)phenyl]sulfonyl-3-cyclohexylurea;hydrochloride. InChIKey: UNCHGKRSPCJFJU-UHFFFAOYSA-N.
| Molecular formula | C15H24ClN3O3S |
|---|---|
| Molecular weight | 361.9 g/mol |
| IUPAC name | 1-[4-(2-aminoethyl)phenyl]sulfonyl-3-cyclohexylurea;hydrochloride |
| InChIKey | UNCHGKRSPCJFJU-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)NS(=O)(=O)C2=CC=C(C=C2)CCN.Cl |
Computed by PubChem (NCBI)