CAS 142861-23-2 is the registry number for 4-(3-Aminophenyl)-5-methyl-4H-1,2,4-triazole-3-thiol hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(3-aminophenyl)-3-methyl-1H-1,2,4-triazole-5-thione;hydrochloride (CAS 142861-23-2) is a chemical compound with the molecular formula C9H11ClN4S and a molecular weight of 242.73 g/mol. IUPAC name: 4-(3-aminophenyl)-3-methyl-1H-1,2,4-triazole-5-thione;hydrochloride. InChIKey: WSQALNLQOIXBCT-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN4S |
|---|---|
| Molecular weight | 242.73 g/mol |
| IUPAC name | 4-(3-aminophenyl)-3-methyl-1H-1,2,4-triazole-5-thione;hydrochloride |
| InChIKey | WSQALNLQOIXBCT-UHFFFAOYSA-N |
| SMILES | CC1=NNC(=S)N1C2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)