CAS 1428630-85-6 appears in our catalog under these names: (R)-5-((3-Fluorophenyl)ethynyl)-N-(3-hydroxy-3-methylbutan-2-yl)picolinamide, 98%, VU0424465, VU 0424465, VU 0424465, VU0424465, 99.84%. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 50mg, 5mg, 25mg, 100mg, 10 mg, 5 mg.
5-[2-(3-fluorophenyl)ethynyl]-N-[(2R)-3-hydroxy-3-methylbutan-2-yl]pyridine-2-carboxamide (CAS 1428630-85-6) is a chemical compound with the molecular formula C19H19FN2O2 and a molecular weight of 326.4 g/mol. IUPAC name: 5-[2-(3-fluorophenyl)ethynyl]-N-[(2R)-3-hydroxy-3-methylbutan-2-yl]pyridine-2-carboxamide. InChIKey: ZPKZAFDYFVJULO-CYBMUJFWSA-N.
| Molecular formula | C19H19FN2O2 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 5-[2-(3-fluorophenyl)ethynyl]-N-[(2R)-3-hydroxy-3-methylbutan-2-yl]pyridine-2-carboxamide |
| InChIKey | ZPKZAFDYFVJULO-CYBMUJFWSA-N |
| SMILES | C[C@H](C(C)(C)O)NC(=O)C1=NC=C(C=C1)C#CC2=CC(=CC=C2)F |
Computed by PubChem (NCBI)