CAS 1428732-23-3 is the registry number for 3,3,6-Trimethyl-1-(methylsulfanyl)-3,4-dihydroisoquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3,3,6-trimethyl-1-methylsulfanyl-4H-isoquinoline (CAS 1428732-23-3) is a chemical compound with the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. IUPAC name: 3,3,6-trimethyl-1-methylsulfanyl-4H-isoquinoline. InChIKey: SBJJBDZZWXHZSG-UHFFFAOYSA-N.
| Molecular formula | C13H17NS |
|---|---|
| Molecular weight | 219.35 g/mol |
| IUPAC name | 3,3,6-trimethyl-1-methylsulfanyl-4H-isoquinoline |
| InChIKey | SBJJBDZZWXHZSG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=NC(C2)(C)C)SC |
Computed by PubChem (NCBI)