Products 142886-72-4
CAS 142886-72-4 is the registry number for 1,3-Butadiene Diepoxide-D6. Offered by: TRC. Available pack sizes: 25mg.
2,2,3-trideuterio-3-(2,3,3-trideuteriooxiran-2-yl)oxirane (CAS 142886-72-4) is a chemical compound with the molecular formula C4H6O2 and a molecular weight of 92.13 g/mol. IUPAC name: 2,2,3-trideuterio-3-(2,3,3-trideuteriooxiran-2-yl)oxirane. InChIKey: ZFIVKAOQEXOYFY-UFSLNRCZSA-N.
| Molecular formula | C4H6O2 |
|---|---|
| Molecular weight | 92.13 g/mol |
| IUPAC name | 2,2,3-trideuterio-3-(2,3,3-trideuteriooxiran-2-yl)oxirane |
| InChIKey | ZFIVKAOQEXOYFY-UFSLNRCZSA-N |
| SMILES | [2H]C1(C(O1)([2H])C2(C(O2)([2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)