CAS 1429-50-1 appears in our catalog under these names: Ethylenediamine tetramethylenephosphonic Acid, Ethylenediaminetetra(methylenephosphonic acid), ((Ethane–1,2–diylbis(azanetriyl))tetrakis(methylene))tetraphosphonic acid, N,N,N',N'-Ethylenediaminetetrakis, N,N,N',N'-Ethylenediaminetetrakis(methylenephosphonic Acid), >95.0%(T). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 5g, 100g, 500g, 25g, 10g, 50g, 1 g.
[2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid (CAS 1429-50-1) is a chemical compound with the molecular formula C6H20N2O12P4 and a molecular weight of 436.12 g/mol. IUPAC name: [2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid. InChIKey: NFDRPXJGHKJRLJ-UHFFFAOYSA-N.
| Molecular formula | C6H20N2O12P4 |
|---|---|
| Molecular weight | 436.12 g/mol |
| IUPAC name | [2-[bis(phosphonomethyl)amino]ethyl-(phosphonomethyl)amino]methylphosphonic acid |
| InChIKey | NFDRPXJGHKJRLJ-UHFFFAOYSA-N |
| SMILES | C(CN(CP(=O)(O)O)CP(=O)(O)O)N(CP(=O)(O)O)CP(=O)(O)O |
Computed by PubChem (NCBI)