Products 1429012-38-3
CAS 1429012-38-3 is the registry number for hGGPPS-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[[(2-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid (CAS 1429012-38-3) is a chemical compound with the molecular formula C13H13N3O6P2S and a molecular weight of 401.27 g/mol. IUPAC name: [[(2-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid. InChIKey: OVNNLIKSDUSVRR-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O6P2S |
|---|---|
| Molecular weight | 401.27 g/mol |
| IUPAC name | [[(2-phenylthieno[2,3-d]pyrimidin-4-yl)amino]-phosphonomethyl]phosphonic acid |
| InChIKey | OVNNLIKSDUSVRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC(=C3C=CSC3=N2)NC(P(=O)(O)O)P(=O)(O)O |
Computed by PubChem (NCBI)