Products 1429056-43-8
CAS 1429056-43-8 is the registry number for 4,5-Dichloro-3-(trifluoromethyl)-1,2-thiazole, 99%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
4,5-dichloro-3-(trifluoromethyl)-1,2-thiazole (CAS 1429056-43-8) is a chemical compound with the molecular formula C4Cl2F3NS and a molecular weight of 222.01 g/mol. IUPAC name: 4,5-dichloro-3-(trifluoromethyl)-1,2-thiazole. InChIKey: SVWUJHFYRPRHOT-UHFFFAOYSA-N.
| Molecular formula | C4Cl2F3NS |
|---|---|
| Molecular weight | 222.01 g/mol |
| IUPAC name | 4,5-dichloro-3-(trifluoromethyl)-1,2-thiazole |
| InChIKey | SVWUJHFYRPRHOT-UHFFFAOYSA-N |
| SMILES | C1(=C(SN=C1C(F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)