CAS 1429071-63-5 appears in our catalog under these names: Ebastine EP Impurity F, Ebastine EP Impurity F (cis-Ebastine N-Oxide). Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-benzhydryloxy-1-oxidopiperidin-1-ium-1-yl)-1-(4-tert-butylphenyl)butan-1-one (CAS 1429071-63-5) is a chemical compound with the molecular formula C32H39NO3 and a molecular weight of 485.7 g/mol. IUPAC name: 4-(4-benzhydryloxy-1-oxidopiperidin-1-ium-1-yl)-1-(4-tert-butylphenyl)butan-1-one. InChIKey: PFOUEGNOVHBNHS-UHFFFAOYSA-N.
| Molecular formula | C32H39NO3 |
|---|---|
| Molecular weight | 485.7 g/mol |
| IUPAC name | 4-(4-benzhydryloxy-1-oxidopiperidin-1-ium-1-yl)-1-(4-tert-butylphenyl)butan-1-one |
| InChIKey | PFOUEGNOVHBNHS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(=O)CCC[N+]2(CCC(CC2)OC(C3=CC=CC=C3)C4=CC=CC=C4)[O-] |
Computed by PubChem (NCBI)