CAS 1429181-55-4 is the registry number for tert-butyl (S)-(1-(4-((4,4-difluoropiperidin-1-yl)methyl)phenyl)ethyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(1S)-1-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]ethyl]carbamate (CAS 1429181-55-4) is a chemical compound with the molecular formula C19H28F2N2O2 and a molecular weight of 354.4 g/mol. IUPAC name: tert-butyl N-[(1S)-1-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]ethyl]carbamate. InChIKey: SSUCLIDFRKIXTP-AWEZNQCLSA-N.
| Molecular formula | C19H28F2N2O2 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | tert-butyl N-[(1S)-1-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenyl]ethyl]carbamate |
| InChIKey | SSUCLIDFRKIXTP-AWEZNQCLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)CN2CCC(CC2)(F)F)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)