CAS 1429183-01-6 is the registry number for (S)-4-(1-Aminoethyl)phenol HCl. Offered by: Biosynth. Available pack sizes: 1g, 0,5g, 5g, 10g.
4-[(1S)-1-aminoethyl]phenol;hydrochloride (CAS 1429183-01-6) is a chemical compound with the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. IUPAC name: 4-[(1S)-1-aminoethyl]phenol;hydrochloride. InChIKey: HNDFWZASJWHBCZ-RGMNGODLSA-N.
| Molecular formula | C8H12ClNO |
|---|---|
| Molecular weight | 173.64 g/mol |
| IUPAC name | 4-[(1S)-1-aminoethyl]phenol;hydrochloride |
| InChIKey | HNDFWZASJWHBCZ-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)