CAS 1429233-51-1 is the registry number for 6-Cyclopropyl-1-(4-fluorophenyl)-1,5-dihydro-4H-pyrazolo[3,4-d]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-cyclopropyl-1-(4-fluorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one (CAS 1429233-51-1) is a chemical compound with the molecular formula C14H11FN4O and a molecular weight of 270.26 g/mol. IUPAC name: 6-cyclopropyl-1-(4-fluorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one. InChIKey: RGVKZBGMZLLFBF-UHFFFAOYSA-N.
| Molecular formula | C14H11FN4O |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | 6-cyclopropyl-1-(4-fluorophenyl)-5H-pyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | RGVKZBGMZLLFBF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=C(C=NN3C4=CC=C(C=C4)F)C(=O)N2 |
Computed by PubChem (NCBI)