Products 1429374-83-3
CAS 1429374-83-3 appears in our catalog under these names: Izuforant, Izuforant, 98.88%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 10mM (in 1ml dmso), 10 mg, 5 mg, 25 mg, 10mM/1mL, 50 mg.
1-(12-bromo-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine (CAS 1429374-83-3) is a chemical compound with the molecular formula C12H12BrN7 and a molecular weight of 334.17 g/mol. IUPAC name: 1-(12-bromo-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine. InChIKey: MMVBKZHQTLDYKG-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN7 |
|---|---|
| Molecular weight | 334.17 g/mol |
| IUPAC name | 1-(12-bromo-2,4,5,8,10-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-7-yl)-N-methylazetidin-3-amine |
| InChIKey | MMVBKZHQTLDYKG-UHFFFAOYSA-N |
| SMILES | CNC1CN(C1)C2=NC3=C(C=C(C=N3)Br)N4C2=NN=C4 |
Computed by PubChem (NCBI)