CAS 1429418-88-1 is the registry number for 1-(2-Fluoroethyl)-4-nitro-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
1-(2-fluoroethyl)-4-nitropyrazole (CAS 1429418-88-1) is a chemical compound with the molecular formula C5H6FN3O2 and a molecular weight of 159.12 g/mol. IUPAC name: 1-(2-fluoroethyl)-4-nitropyrazole. InChIKey: RKIKDIVGRMPBJM-UHFFFAOYSA-N.
| Molecular formula | C5H6FN3O2 |
|---|---|
| Molecular weight | 159.12 g/mol |
| IUPAC name | 1-(2-fluoroethyl)-4-nitropyrazole |
| InChIKey | RKIKDIVGRMPBJM-UHFFFAOYSA-N |
| SMILES | C1=C(C=NN1CCF)[N+](=O)[O-] |
Computed by PubChem (NCBI)