CAS 1429428-81-8 is the registry number for (3R)-Azepan-3-amine Mandelate. Offered by: TRC. Available pack sizes: 50mg.
(3R)-azepan-3-amine;(2S)-2-hydroxy-2-phenylacetic acid (CAS 1429428-81-8) is a chemical compound with the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. IUPAC name: (3R)-azepan-3-amine;(2S)-2-hydroxy-2-phenylacetic acid. InChIKey: LIYRZJUVVLQTRU-MIIJMEOFSA-N.
| Molecular formula | C14H22N2O3 |
|---|---|
| Molecular weight | 266.34 g/mol |
| IUPAC name | (3R)-azepan-3-amine;(2S)-2-hydroxy-2-phenylacetic acid |
| InChIKey | LIYRZJUVVLQTRU-MIIJMEOFSA-N |
| SMILES | C1CCNC[C@@H](C1)N.C1=CC=C(C=C1)[C@@H](C(=O)O)O |
Computed by PubChem (NCBI)