CAS 142946-79-0 appears in our catalog under these names: 4,4'-Bis(trifluoromethyl)-2,2'-bipyridyl, 95-<97%, 4,4'-Bis(trifluoromethyl)-2,2'-bipyridyl, ≥97-<99%, 4,4'–tfmbpy, 4,4'-Bis(trifluoromethyl)-2,2'-bipyridyl, >98.0%(GC)(T), 4,4'-Bis(trifluoromethyl)-2,2'-bipyridine. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Biosynth, Ambeed. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 10g, 1g.
4-(trifluoromethyl)-2-[4-(trifluoromethyl)-2-pyridinyl]pyridine (CAS 142946-79-0) is a chemical compound with the molecular formula C12H6F6N2 and a molecular weight of 292.18 g/mol. IUPAC name: 4-(trifluoromethyl)-2-[4-(trifluoromethyl)-2-pyridinyl]pyridine. InChIKey: FFOMEQIMPYKURW-UHFFFAOYSA-N.
| Molecular formula | C12H6F6N2 |
|---|---|
| Molecular weight | 292.18 g/mol |
| IUPAC name | 4-(trifluoromethyl)-2-[4-(trifluoromethyl)-2-pyridinyl]pyridine |
| InChIKey | FFOMEQIMPYKURW-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1C(F)(F)F)C2=NC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)