CAS 1429493-90-2 appears in our catalog under these names: 2-[(3,5-Dimethyl-1-adamantyl)amino]ethanol hydrochloride, 95%, 2-((3,5-Dimethyl-1-adamantyl)amino)ethanol hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[(3,5-dimethyl-1-adamantyl)amino]ethanol;hydrochloride (CAS 1429493-90-2) is a chemical compound with the molecular formula C14H26ClNO and a molecular weight of 259.81 g/mol. IUPAC name: 2-[(3,5-dimethyl-1-adamantyl)amino]ethanol;hydrochloride. InChIKey: WOBKSDWYDZKBQI-UHFFFAOYSA-N.
| Molecular formula | C14H26ClNO |
|---|---|
| Molecular weight | 259.81 g/mol |
| IUPAC name | 2-[(3,5-dimethyl-1-adamantyl)amino]ethanol;hydrochloride |
| InChIKey | WOBKSDWYDZKBQI-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)NCCO)C.Cl |
Computed by PubChem (NCBI)