Products 14295-43-3
CAS 14295-43-3 is the registry number for C.I.Pigment red 88. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E)-4,7-dichloro-2-(4,7-dichloro-3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one (CAS 14295-43-3) is a chemical compound with the molecular formula C16H4Cl4O2S2 and a molecular weight of 434.1 g/mol. IUPAC name: (2E)-4,7-dichloro-2-(4,7-dichloro-3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one. InChIKey: KZFMOINJHMONLW-FOCLMDBBSA-N.
| Molecular formula | C16H4Cl4O2S2 |
|---|---|
| Molecular weight | 434.1 g/mol |
| IUPAC name | (2E)-4,7-dichloro-2-(4,7-dichloro-3-oxo-1-benzothiophen-2-ylidene)-1-benzothiophen-3-one |
| InChIKey | KZFMOINJHMONLW-FOCLMDBBSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)C(=O)/C(=C\3/C(=O)C4=C(C=CC(=C4S3)Cl)Cl)/S2)Cl |
Computed by PubChem (NCBI)