CAS 14299-53-7 appears in our catalog under these names: 1-(2,4,5-Trichlorophenyl)-1,2-ethanediol, 2,4,5-Trichlorophenylethanediol, >95% (HPLC). Offered by: Dr. Ehrenstorfer, TRC. Available pack sizes: 10mg, 100mg, 1g, 500mg.
1-(2,4,5-trichlorophenyl)ethane-1,2-diol (CAS 14299-53-7) is a chemical compound with the molecular formula C8H7Cl3O2 and a molecular weight of 241.5 g/mol. IUPAC name: 1-(2,4,5-trichlorophenyl)ethane-1,2-diol. InChIKey: CWGHUMHHVXHYAY-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl3O2 |
|---|---|
| Molecular weight | 241.5 g/mol |
| IUPAC name | 1-(2,4,5-trichlorophenyl)ethane-1,2-diol |
| InChIKey | CWGHUMHHVXHYAY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C(CO)O |
Computed by PubChem (NCBI)