Products 142999-59-5
CAS 142999-59-5 is the registry number for GYKI-46903. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(4R,5S)-6-(4-fluorophenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] propanoate;hydrochloride (CAS 142999-59-5) is a chemical compound with the molecular formula C17H21ClFNO2 and a molecular weight of 325.8 g/mol. IUPAC name: [(4R,5S)-6-(4-fluorophenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] propanoate;hydrochloride. InChIKey: UBIAWBSPCYNXMC-QNBGGDODSA-N.
| Molecular formula | C17H21ClFNO2 |
|---|---|
| Molecular weight | 325.8 g/mol |
| IUPAC name | [(4R,5S)-6-(4-fluorophenyl)-1-azabicyclo[3.3.1]non-6-en-4-yl] propanoate;hydrochloride |
| InChIKey | UBIAWBSPCYNXMC-QNBGGDODSA-N |
| SMILES | CCC(=O)O[C@@H]1CCN2CC=C([C@H]1C2)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)