CAS 143-18-0 appears in our catalog under these names: Potassium oleate, 98%, Potassium oleate, Potassium Oleate, >98.0%(T), Potassium oleate 98%, POTASSIUM OLEATE. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 500g, 100g, 1kg, 25g, 1000g, 250G, 50 g.
Potassium (Z)-octadec-9-enoate (CAS 143-18-0) is a chemical compound with the molecular formula C18H33KO2 and a molecular weight of 320.6 g/mol. IUPAC name: potassium (Z)-octadec-9-enoate. InChIKey: MLICVSDCCDDWMD-KVVVOXFISA-M.
| Molecular formula | C18H33KO2 |
|---|---|
| Molecular weight | 320.6 g/mol |
| IUPAC name | potassium (Z)-octadec-9-enoate |
| InChIKey | MLICVSDCCDDWMD-KVVVOXFISA-M |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)