CAS 143-98-6 appears in our catalog under these names: Dextrorphan L-Tartrate (Dextromethorphan EP Impurity B L-Tartrate), Dextrorphan Tartrate Salt, >95% (HPLC), Dextrorphan tartrate, Dextrorphan Tartrate (O-Desmethyldextro-methorphan Tartrate, ent-17-Methylmorphinan-3-ol (L)-Tartrate), Dextrorphan Tartrate (O-Desmethyldextromethorphan Tartrate, ent-17-Methylmorphinan-3-ol (L)-Tartrate) 1.0 mg/ml in Methanol (as free base). Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, LoGiCal, Mikromol. Available pack sizes: on request, 100mg, 500mg, 50mg, 10mg, 1ml, 25mg, 1mg.
(2R,3R)-2,3-dihydroxybutanedioic acid;(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (CAS 143-98-6) is a chemical compound with the molecular formula C21H29NO7 and a molecular weight of 407.5 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol. InChIKey: RWTWIZDKEIWLKQ-XCPWPWHNSA-N.
| Molecular formula | C21H29NO7 |
|---|---|
| Molecular weight | 407.5 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;(1S,9S,10S)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| InChIKey | RWTWIZDKEIWLKQ-XCPWPWHNSA-N |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)O.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)