CAS 1430056-54-4 appears in our catalog under these names: AKT–IN–6, AKT-IN-6/ 98.83% (existing batch purity), AKT-IN-6, AKT-IN-6, 99.08%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 100mg, 500mg, 200mg.
5-[2-[(2S)-1-amino-3-(3-fluorophenyl)propan-2-yl]-1-oxo-3H-isoindol-5-yl]-1-methylpyrazole-4-carbonitrile (CAS 1430056-54-4) is a chemical compound with the molecular formula C22H20FN5O and a molecular weight of 389.4 g/mol. IUPAC name: 5-[2-[(2S)-1-amino-3-(3-fluorophenyl)propan-2-yl]-1-oxo-3H-isoindol-5-yl]-1-methylpyrazole-4-carbonitrile. InChIKey: QXRHOURHCGFDIM-IBGZPJMESA-N.
| Molecular formula | C22H20FN5O |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 5-[2-[(2S)-1-amino-3-(3-fluorophenyl)propan-2-yl]-1-oxo-3H-isoindol-5-yl]-1-methylpyrazole-4-carbonitrile |
| InChIKey | QXRHOURHCGFDIM-IBGZPJMESA-N |
| SMILES | CN1C(=C(C=N1)C#N)C2=CC3=C(C=C2)C(=O)N(C3)[C@@H](CC4=CC(=CC=C4)F)CN |
Computed by PubChem (NCBI)