CAS 1430089-64-7 appears in our catalog under these names: 2,4-Pyrimidinediamine with linker, 95%, VEGFR-2-IN-5/ 98.13% (existing batch purity), 2,4–Pyrimidinediamine with linker, UNC0064-12, VEGFR-2-IN-5 98+%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 1g, 250mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg.
2-N-[4-(3-aminopropylamino)phenyl]-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine (CAS 1430089-64-7) is a chemical compound with the molecular formula C19H24N8 and a molecular weight of 364.4 g/mol. IUPAC name: 2-N-[4-(3-aminopropylamino)phenyl]-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine. InChIKey: UYYZTTPXKIYERF-UHFFFAOYSA-N.
| Molecular formula | C19H24N8 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 2-N-[4-(3-aminopropylamino)phenyl]-4-N-(5-cyclopropyl-1H-pyrazol-3-yl)pyrimidine-2,4-diamine |
| InChIKey | UYYZTTPXKIYERF-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NN2)NC3=NC(=NC=C3)NC4=CC=C(C=C4)NCCCN |
Computed by PubChem (NCBI)