CAS 143030-47-1 is the registry number for CGP 47645. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-[(4-cyanophenyl)-fluoro-(1,2,4-triazol-1-yl)methyl]benzonitrile (CAS 143030-47-1) is a chemical compound with the molecular formula C17H10FN5 and a molecular weight of 303.29 g/mol. IUPAC name: 4-[(4-cyanophenyl)-fluoro-(1,2,4-triazol-1-yl)methyl]benzonitrile. InChIKey: PZDLRBUQYWMNBR-UHFFFAOYSA-N.
| Molecular formula | C17H10FN5 |
|---|---|
| Molecular weight | 303.29 g/mol |
| IUPAC name | 4-[(4-cyanophenyl)-fluoro-(1,2,4-triazol-1-yl)methyl]benzonitrile |
| InChIKey | PZDLRBUQYWMNBR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C(C2=CC=C(C=C2)C#N)(N3C=NC=N3)F |
Computed by PubChem (NCBI)