CAS 1430403-93-2 is the registry number for 1,4–Diethynyl–2,3–difluorobenzene. Offered by: GLPBio. Available pack sizes: 5g.
1,4-diethynyl-2,3-difluorobenzene (CAS 1430403-93-2) is a chemical compound with the molecular formula C10H4F2 and a molecular weight of 162.13 g/mol. IUPAC name: 1,4-diethynyl-2,3-difluorobenzene. InChIKey: VJHNJBKGFCOZHR-UHFFFAOYSA-N.
| Molecular formula | C10H4F2 |
|---|---|
| Molecular weight | 162.13 g/mol |
| IUPAC name | 1,4-diethynyl-2,3-difluorobenzene |
| InChIKey | VJHNJBKGFCOZHR-UHFFFAOYSA-N |
| SMILES | C#CC1=C(C(=C(C=C1)C#C)F)F |
Computed by PubChem (NCBI)