CAS 1430561-06-0 appears in our catalog under these names: 6-((2-Aminoethyl)amino)-2,3-dihydroisoquinolino[6,7-f]quinoxaline-7,12-diol, 95%, 6,7-Piperazine Pixantrone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
6-(2-aminoethylamino)-2,3-dihydroisoquinolino[6,7-f]quinoxaline-7,12-diol (CAS 1430561-06-0) is a chemical compound with the molecular formula C17H17N5O2 and a molecular weight of 323.35 g/mol. IUPAC name: 6-(2-aminoethylamino)-2,3-dihydroisoquinolino[6,7-f]quinoxaline-7,12-diol. InChIKey: UWJICVIMVLABIP-UHFFFAOYSA-N.
| Molecular formula | C17H17N5O2 |
|---|---|
| Molecular weight | 323.35 g/mol |
| IUPAC name | 6-(2-aminoethylamino)-2,3-dihydroisoquinolino[6,7-f]quinoxaline-7,12-diol |
| InChIKey | UWJICVIMVLABIP-UHFFFAOYSA-N |
| SMILES | C1CN=C2C(=N1)C=C(C3=C(C4=C(C=CN=C4)C(=C32)O)O)NCCN |
Computed by PubChem (NCBI)