CAS 14307-43-8 appears in our catalog under these names: Ammonium tartrate, 98%, (2R,3R)-2,3-Dihydroxysuccinic acid, ammonia salt(1:x), 99%, ammonium (R–(R*,R*))–tartrate, Ammonium tartrate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 500g, 100g, 25g, 1000g, 2.5kg.
Azane;(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 14307-43-8) is a chemical compound with the molecular formula C4H9NO6 and a molecular weight of 167.12 g/mol. IUPAC name: azane;(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: ZMFVLYPTTFPBNG-ZVGUSBNCSA-N.
| Molecular formula | C4H9NO6 |
|---|---|
| Molecular weight | 167.12 g/mol |
| IUPAC name | azane;(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | ZMFVLYPTTFPBNG-ZVGUSBNCSA-N |
| SMILES | [C@@H]([C@H](C(=O)O)O)(C(=O)O)O.N |
Computed by PubChem (NCBI)