CAS 1430845-69-4 is the registry number for 1-(Adamantan-1-ylmethyl)-4-bromo-5-methyl-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
1-(1-adamantylmethyl)-4-bromo-5-methylpyrazole (CAS 1430845-69-4) is a chemical compound with the molecular formula C15H21BrN2 and a molecular weight of 309.24 g/mol. IUPAC name: 1-(1-adamantylmethyl)-4-bromo-5-methylpyrazole. InChIKey: PUAWFEXCUFIIIZ-UHFFFAOYSA-N.
| Molecular formula | C15H21BrN2 |
|---|---|
| Molecular weight | 309.24 g/mol |
| IUPAC name | 1-(1-adamantylmethyl)-4-bromo-5-methylpyrazole |
| InChIKey | PUAWFEXCUFIIIZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=NN1CC23CC4CC(C2)CC(C4)C3)Br |
Computed by PubChem (NCBI)