CAS 1431-00-1 appears in our catalog under these names: 3,6-Dimethylpyrazolo(1,5-a)pyrimidin-7-amine, 98%, 3,6-Dimethylpyrazolo(1,5-a)pyrimidin-7-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
3,6-dimethylpyrazolo[1,5-a]pyrimidin-7-amine (CAS 1431-00-1) is a chemical compound with the molecular formula C8H10N4 and a molecular weight of 162.19 g/mol. IUPAC name: 3,6-dimethylpyrazolo[1,5-a]pyrimidin-7-amine. InChIKey: GJYPOUWCAHWNAL-UHFFFAOYSA-N.
| Molecular formula | C8H10N4 |
|---|---|
| Molecular weight | 162.19 g/mol |
| IUPAC name | 3,6-dimethylpyrazolo[1,5-a]pyrimidin-7-amine |
| InChIKey | GJYPOUWCAHWNAL-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=C(C=N2)C)N=C1)N |
Computed by PubChem (NCBI)