CAS 1431-30-7 is the registry number for L589420-0-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2,3-dichloro-4-[(E)-2-ethylbut-2-enoyl]phenoxy]acetic acid (CAS 1431-30-7) is a chemical compound with the molecular formula C14H14Cl2O4 and a molecular weight of 317.2 g/mol. IUPAC name: 2-[2,3-dichloro-4-[(E)-2-ethylbut-2-enoyl]phenoxy]acetic acid. InChIKey: PDQHXCCDRYPJFA-FPYGCLRLSA-N.
| Molecular formula | C14H14Cl2O4 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2-[2,3-dichloro-4-[(E)-2-ethylbut-2-enoyl]phenoxy]acetic acid |
| InChIKey | PDQHXCCDRYPJFA-FPYGCLRLSA-N |
| SMILES | CC/C(=C\C)/C(=O)C1=C(C(=C(C=C1)OCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)