Products 143127-83-7

CAS 143127-83-7 appears in our catalog under these names: 3,4-Dihydro-1H-2-benzothiopyran-4-amine hydrochloride, 95%, 3,4-Dihydro-1H-2-benzothiopyran-4-amine hydrochloride, Isothiochroman-4-amine hydrochloride, 95%, 95%, Isothiochroman-4-amine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 2,5g, 250mg, 100mg, 50mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3,4-dihydro-1H-isothiochromen-4-amine;hydrochloride (CAS 143127-83-7) is a chemical compound with the molecular formula C9H12ClNS and a molecular weight of 201.72 g/mol. IUPAC name: 3,4-dihydro-1H-isothiochromen-4-amine;hydrochloride. InChIKey: NZDWPPWVNMWXBR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12ClNS
Molecular weight201.72 g/mol
IUPAC name3,4-dihydro-1H-isothiochromen-4-amine;hydrochloride
InChIKeyNZDWPPWVNMWXBR-UHFFFAOYSA-N
SMILESC1C(C2=CC=CC=C2CS1)N.Cl

Computed by PubChem (NCBI)