CAS 143128-30-7 is the registry number for 1-(4-Iodobenzyl)-1H-pyrazole, 95% . Offered by: Thermo Scientific. Available pack sizes: 1g.
1-[(4-iodophenyl)methyl]pyrazole (CAS 143128-30-7) is a chemical compound with the molecular formula C10H9IN2 and a molecular weight of 284.10 g/mol. IUPAC name: 1-[(4-iodophenyl)methyl]pyrazole. InChIKey: QRCIIHVBALOAQK-UHFFFAOYSA-N.
| Molecular formula | C10H9IN2 |
|---|---|
| Molecular weight | 284.10 g/mol |
| IUPAC name | 1-[(4-iodophenyl)methyl]pyrazole |
| InChIKey | QRCIIHVBALOAQK-UHFFFAOYSA-N |
| SMILES | C1=CN(N=C1)CC2=CC=C(C=C2)I |
Computed by PubChem (NCBI)