CAS 1431304-52-7 is the registry number for (1S,2S)-Rel-2-(2-bromo-1,3-thiazol-5-yl)cyclopropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1S,2S)-2-(2-bromo-1,3-thiazol-5-yl)cyclopropan-1-amine (CAS 1431304-52-7) is a chemical compound with the molecular formula C6H7BrN2S and a molecular weight of 219.10 g/mol. IUPAC name: trans-(1S,2S)-2-(2-bromo-1,3-thiazol-5-yl)cyclopropan-1-amine. InChIKey: ZRHCYSZEBJVJGK-IMJSIDKUSA-N.
| Molecular formula | C6H7BrN2S |
|---|---|
| Molecular weight | 219.10 g/mol |
| IUPAC name | trans-(1S,2S)-2-(2-bromo-1,3-thiazol-5-yl)cyclopropan-1-amine |
| InChIKey | ZRHCYSZEBJVJGK-IMJSIDKUSA-N |
| SMILES | C1[C@@H]([C@H]1N)C2=CN=C(S2)Br |
Computed by PubChem (NCBI)