CAS 143131-07-1 is the registry number for N-(4-Carboxybenzyl)-N,N-dimethyloctan-1-aminium Sulfate. Offered by: TRC. Available pack sizes: 250mg.
(4-carboxyphenyl)methyl-dimethyl-octylazanium;hydrogen sulfate (CAS 143131-07-1) is a chemical compound with the molecular formula C18H31NO6S and a molecular weight of 389.5 g/mol. IUPAC name: (4-carboxyphenyl)methyl-dimethyl-octylazanium;hydrogen sulfate. InChIKey: SOYIKLOJXWYSST-UHFFFAOYSA-N.
| Molecular formula | C18H31NO6S |
|---|---|
| Molecular weight | 389.5 g/mol |
| IUPAC name | (4-carboxyphenyl)methyl-dimethyl-octylazanium;hydrogen sulfate |
| InChIKey | SOYIKLOJXWYSST-UHFFFAOYSA-N |
| SMILES | CCCCCCCC[N+](C)(C)CC1=CC=C(C=C1)C(=O)O.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)