CAS 1431322-87-0 appears in our catalog under these names: 4-((Trimethylsilyl)ethynyl)benzene-1,2-diamine, 95%, 4-(2-trimethylsilylethynyl)benzene-1,2-diamine, 97%, 97%, 4-((Trimethylsilyl)ethynyl)benzene-1,2-diamine, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
4-(2-trimethylsilylethynyl)benzene-1,2-diamine (CAS 1431322-87-0) is a chemical compound with the molecular formula C11H16N2Si and a molecular weight of 204.34 g/mol. IUPAC name: 4-(2-trimethylsilylethynyl)benzene-1,2-diamine. InChIKey: OOLGMYGSIYYNAN-UHFFFAOYSA-N.
| Molecular formula | C11H16N2Si |
|---|---|
| Molecular weight | 204.34 g/mol |
| IUPAC name | 4-(2-trimethylsilylethynyl)benzene-1,2-diamine |
| InChIKey | OOLGMYGSIYYNAN-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=CC(=C(C=C1)N)N |
Computed by PubChem (NCBI)