CAS 1431365-56-8 is the registry number for (1R*,2S*,4S*)-7-Aza-bicyclo[2.2.1]heptane-2-carboxylic acid hydrobromide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(1R,2S,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;hydrobromide (CAS 1431365-56-8) is a chemical compound with the molecular formula C7H12BrNO2 and a molecular weight of 222.08 g/mol. IUPAC name: (1R,2S,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;hydrobromide. InChIKey: VQBVIXGGYLNGIJ-WLUDYRNVSA-N.
| Molecular formula | C7H12BrNO2 |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | (1R,2S,4S)-7-azabicyclo[2.2.1]heptane-2-carboxylic acid;hydrobromide |
| InChIKey | VQBVIXGGYLNGIJ-WLUDYRNVSA-N |
| SMILES | C1C[C@@H]2[C@H](C[C@H]1N2)C(=O)O.Br |
Computed by PubChem (NCBI)