CAS 1431511-18-0 appears in our catalog under these names: (S)-Fesoterodine Fumarate, Fesoterodine Fumarate S-Isomer. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 10mg, 5mg.
(E)-but-2-enedioic acid;[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate (CAS 1431511-18-0) is a chemical compound with the molecular formula C30H41NO7 and a molecular weight of 527.6 g/mol. IUPAC name: (E)-but-2-enedioic acid;[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate. InChIKey: MWHXMIASLKXGBU-LASJEQTRSA-N.
| Molecular formula | C30H41NO7 |
|---|---|
| Molecular weight | 527.6 g/mol |
| IUPAC name | (E)-but-2-enedioic acid;[2-[(1S)-3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenyl] 2-methylpropanoate |
| InChIKey | MWHXMIASLKXGBU-LASJEQTRSA-N |
| SMILES | CC(C)C(=O)OC1=C(C=C(C=C1)CO)[C@@H](CCN(C(C)C)C(C)C)C2=CC=CC=C2.C(=C/C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)