Products 1431551-89-1
CAS 1431551-89-1 is the registry number for tert-butyl 2-(4-bromophenyl)azetidine-1-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 2-(4-bromophenyl)azetidine-1-carboxylate (CAS 1431551-89-1) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: tert-butyl 2-(4-bromophenyl)azetidine-1-carboxylate. InChIKey: NZXOMGRTTFEYIY-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | tert-butyl 2-(4-bromophenyl)azetidine-1-carboxylate |
| InChIKey | NZXOMGRTTFEYIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC1C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)