CAS 143157-24-8 appears in our catalog under these names: Gemcitabine Impurity 22, 1’-Epi 2’,2’-Difluoro-2’-deoxyuridine 3',5'-Dibenzoate, 1'-Epi 2',2'-difluoro-2'-deoxyuridine 3',5'-dibenzoate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 25mg, 10mg, 50mg.
[(2R,3S,5S)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methyl benzoate (CAS 143157-24-8) is a chemical compound with the molecular formula C23H18F2N2O7 and a molecular weight of 472.4 g/mol. IUPAC name: [(2R,3S,5S)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methyl benzoate. InChIKey: DBSVRWFIIMWGLT-MMOPVJDHSA-N.
| Molecular formula | C23H18F2N2O7 |
|---|---|
| Molecular weight | 472.4 g/mol |
| IUPAC name | [(2R,3S,5S)-3-benzoyloxy-5-(2,4-dioxopyrimidin-1-yl)-4,4-difluorooxolan-2-yl]methyl benzoate |
| InChIKey | DBSVRWFIIMWGLT-MMOPVJDHSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@@H](C([C@H](O2)N3C=CC(=O)NC3=O)(F)F)OC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)