CAS 143157-25-9 appears in our catalog under these names: Gemcitabine Impurity 10, ((2R,3R,5R)-3-(Benzoyloxy)-4,4-difluoro-5-hydroxytetrahydrofuran-2-yl)methyl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3R,5R)-3-benzoyloxy-4,4-difluoro-5-hydroxyoxolan-2-yl]methyl benzoate (CAS 143157-25-9) is a chemical compound with the molecular formula C19H16F2O6 and a molecular weight of 378.3 g/mol. IUPAC name: [(2R,3R,5R)-3-benzoyloxy-4,4-difluoro-5-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: PRZDMMRKPZAYHW-IIDMSEBBSA-N.
| Molecular formula | C19H16F2O6 |
|---|---|
| Molecular weight | 378.3 g/mol |
| IUPAC name | [(2R,3R,5R)-3-benzoyloxy-4,4-difluoro-5-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | PRZDMMRKPZAYHW-IIDMSEBBSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)OC[C@@H]2[C@H](C([C@@H](O2)O)(F)F)OC(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)