CAS 1431698-47-3 appears in our catalog under these names: Kn-92 hydrochloride, 95%, KN-92 hydrochloride/ 99.71% (existing batch purity), KN–92 hydrochloride, KN-92 hydrochloride, KN-92 HCl, 99.71% ,, 99.71% ,. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 1mg, 5mg, 10mg, 25mg, 50mg.
N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;hydrochloride (CAS 1431698-47-3) is a chemical compound with the molecular formula C24H26Cl2N2O3S and a molecular weight of 493.4 g/mol. IUPAC name: N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;hydrochloride. InChIKey: SHDNWBMPAAXAHM-IPZCTEOASA-N.
| Molecular formula | C24H26Cl2N2O3S |
|---|---|
| Molecular weight | 493.4 g/mol |
| IUPAC name | N-[2-[[[(E)-3-(4-chlorophenyl)prop-2-enyl]-methylamino]methyl]phenyl]-4-methoxybenzenesulfonamide;hydrochloride |
| InChIKey | SHDNWBMPAAXAHM-IPZCTEOASA-N |
| SMILES | CN(C/C=C/C1=CC=C(C=C1)Cl)CC2=CC=CC=C2NS(=O)(=O)C3=CC=C(C=C3)OC.Cl |
Computed by PubChem (NCBI)