CAS 1431699-53-4 appears in our catalog under these names: 3'-Destrifluoromethyl 2'-Trifluoromethyl Cinacalcet, 3’-Destrifluoromethyl 2’-trifluoromethyl cinacalcet, 3'-Destrifluoromethyl 2'-trifluoromethyl cinacalcet, 98%, 98%, Cinacalcet impurity 5, 98.44%, Cinacalcet impurity 5 (Standard). Offered by: TRC, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 5mg, 100 mg, 50 mg, 5 mg, 10 mg.
N-(1-naphthalen-1-ylethyl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine (CAS 1431699-53-4) is a chemical compound with the molecular formula C22H22F3N and a molecular weight of 357.4 g/mol. IUPAC name: N-(1-naphthalen-1-ylethyl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine. InChIKey: GYYWMGJOMCUDDS-UHFFFAOYSA-N.
| Molecular formula | C22H22F3N |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | N-(1-naphthalen-1-ylethyl)-3-[2-(trifluoromethyl)phenyl]propan-1-amine |
| InChIKey | GYYWMGJOMCUDDS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC2=CC=CC=C21)NCCCC3=CC=CC=C3C(F)(F)F |
Computed by PubChem (NCBI)