Products 1431754-15-2
CAS 1431754-15-2 is the registry number for Rezuforimod, 98.63%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 25 mg, 10mM/1mL, 100 mg, 50 mg, 5 mg.
2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]acetic acid (CAS 1431754-15-2) is a chemical compound with the molecular formula C15H20BrN3O4 and a molecular weight of 386.24 g/mol. IUPAC name: 2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]acetic acid. InChIKey: LASJSIMHDHTROE-LBPRGKRZSA-N.
| Molecular formula | C15H20BrN3O4 |
|---|---|
| Molecular weight | 386.24 g/mol |
| IUPAC name | 2-[[(2S)-2-[(4-bromophenyl)carbamoylamino]-4-methylpentanoyl]amino]acetic acid |
| InChIKey | LASJSIMHDHTROE-LBPRGKRZSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)O)NC(=O)NC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)